BD4640141
3-(Methylsulfonylamino)phenylboronicAcid , 98% , 148355-75-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB48.80 | In Stock |
|
| 1g | RMB149.60 | In Stock |
|
| 5g | RMB668.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-96°C |
| Boiling point: | 433.7±55.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| pka | 7.76±0.10(Predicted) |
| form | solid |
| color | Beige |
| InChI | 1S/C7H10BNO4S/c1-14(12,13)9-7-4-2-3-6(5-7)8(10)11/h2-5,9-11H,1H3 |
| InChIKey | XUIQQIRLFMCWLN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Nc1cccc(c1)B(O)O |
| CAS DataBase Reference | 148355-75-3(CAS DataBase Reference) |
Description and Uses
Benzeneboronic acid mediates the ortho specific alpha hydroxyalkylation of phenols by aldehydes. The chemical itself can be used as a template for Diels-Alder reaction by forming linkage with a hydroxy diene and a hydroxy dieneophile.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39-24/25 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |






