A1366712
Bromomalonaldehyde , 97% , 2065-75-0
Synonym(s):
Bromomalondialdehyde
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB49.60 | In Stock |
|
| 50g | RMB95.20 | In Stock |
|
| 100g | RMB175.20 | In Stock |
|
| 250g | RMB415.20 | In Stock |
|
| 500g | RMB784.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-136 °C(lit.) |
| Boiling point: | 134.8±25.0 °C(Predicted) |
| Density | 1.750±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Acetonitrile (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 1.70±0.10(Predicted) |
| color | Pale Beige to Pale Yellow |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C3H3BrO2/c4-3(1-5)2-6/h1-3H |
| InChIKey | SURMYNZXHKLDFO-UHFFFAOYSA-N |
| SMILES | C(=O)C(Br)C=O |
| CAS DataBase Reference | 2065-75-0(CAS DataBase Reference) |
Description and Uses
Used in the formation of glyoxal-derived adducts from substituted guanines
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







