A1367212
4-Bromo-2,6-dimethylaniline , 98% , 24596-19-8
Synonym(s):
4-Bromo-2,6-xylidine
CAS NO.:24596-19-8
Empirical Formula: C8H10BrN
Molecular Weight: 200.08
MDL number: MFCD00007826
EINECS: 246-337-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10G | RMB28.80 | In Stock |
|
| 25G | RMB60.00 | In Stock |
|
| 100G | RMB180.80 | In Stock |
|
| 500g | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-51 °C (lit.) |
| Boiling point: | 120°C 0,2mm |
| Density | 1.4423 (rough estimate) |
| refractive index | 1.5748 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Methanol |
| pka | 3.60±0.10(Predicted) |
| form | Liquid |
| color | Clear yellow to orange to amber |
| BRN | 1936300 |
| InChI | InChI=1S/C8H10BrN/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,10H2,1-2H3 |
| InChIKey | QGLAYJCJLHNIGJ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=C(Br)C=C1C |
| CAS DataBase Reference | 24596-19-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-bromo-2,6-dimethyl-(24596-19-8) |
Description and Uses
4-Bromo-2,6-dimethylaniline has been used in the preparation of:
- 4-bromo-N-(1-(6-(1-isopropyl-1H-benzo[d]imidazol-2-yl)pyridin-2-yl)ethylidene)-2,6-dimethylbenzenamine
- N-(4-Bromo-2,6-dimethylphenyl)-5-trimethylammoniumsalicylaldimine chloride
- ethynyl-functionalized persistent perylene diimide-multichromophore
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H311+H331-H315-H335-H351-H410 |
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P304+P340+P311-P308+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 38-43-36/37/38-20/21/22 |
| Safety Statements | 36/37-36/37/39-26 |
| RIDADR | UN2811/6.1/III |
| WGK Germany | 3 |
| F | 8-10-23 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| HS Code | 29214990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Skin Irrit. 2 STOT SE 3 |









