A1445412
4-Bromo-3-methylaniline , ≥98.0%(GC) , 6933-10-4
Synonym(s):
4-Bromo-m-toluidine
CAS NO.：6933-10-4
Empirical Formula: C7H8BrN
Molecular Weight: 186.05
MDL number: MFCD00007828
EINECS: 230-056-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 10g | RMB70.40 | In Stock |
|
| 50g | RMB135.20 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB335.20 | In Stock |
|
| 500g | RMB1631.20 | In Stock |
|
| 250g | RMB1634.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-82 °C (lit.) |
| Boiling point: | 240 °C (lit.) |
| Density | 1.4700 (rough estimate) |
| refractive index | 1.6190 (estimate) |
| Flash point: | 239-241°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| pka | 4.02±0.10(Predicted) |
| color | Off-white to beige to light brown |
| BRN | 2689600 |
| InChI | InChI=1S/C7H8BrN/c1-5-4-6(9)2-3-7(5)8/h2-4H,9H2,1H3 |
| InChIKey | MMEGELSFOYDPQW-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C(C)=C1 |
| CAS DataBase Reference | 6933-10-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-bromo-3-methyl-(6933-10-4) |
Description and Uses
4-Bromo-3-methylaniline was used in the preparation of 1-(4-bromo-3-methylphenyl)pyrrolidin-2-one.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-33 |
| Safety Statements | 26-37/39-24/25 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921420090 |
