A1367312
2,5-Bis(trifluoromethyl)aniline , 99% , 328-93-8
CAS NO.:328-93-8
Empirical Formula: C8H5F6N
Molecular Weight: 229.12
MDL number: MFCD00074940
EINECS: 629-040-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB79.20 | In Stock |
|
| 100G | RMB295.20 | In Stock |
|
| 500G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 70-71 °C15 mm Hg(lit.) |
| Density | 1.467 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 160 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| pka | 0.24±0.10(Predicted) |
| Specific Gravity | 1.467 |
| color | Clear Colourless |
| BRN | 2653046 |
| InChI | InChI=1S/C8H5F6N/c9-7(10,11)4-1-2-5(6(15)3-4)8(12,13)14/h1-3H,15H2 |
| InChIKey | XWMVIJUAZAEWIE-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(C(F)(F)F)=CC=C1C(F)(F)F |
| CAS DataBase Reference | 328-93-8(CAS DataBase Reference) |
Description and Uses
2,5-Bis(trifluoromethyl)aniline may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







