M7140658
5β-?Dutasteride , ≥98% , 957229-52-6
CAS NO.：957229-52-6
Empirical Formula: C27H30F6N2O2
Molecular Weight: 528.53
MDL number: MFCD24386649
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2352.00 | In Stock |
|
| 50mg | RMB18816.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >292°C (dec.) |
| Boiling point: | 620.3±55.0 °C(Predicted) |
| Density | 1.303±0.06 g/cm3(Predicted) |
| storage temp. | -20°C, Inert atmosphere |
| solubility | DMSO (Slightly) |
| pka | 13.32±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChIKey | JWJOTENAMICLJG-LKOHVCGWSA-N |
| SMILES | N1[C@]2([H])[C@@](C)([C@@]3([H])CC[C@@]4(C)[C@]([H])([C@]3([H])CC2)CC[C@@H]4C(NC2=CC(C(F)(F)F)=CC=C2C(F)(F)F)=O)C=CC1=O |
Description and Uses
5β-Dutasteride is the β-isomer impurity of Dutasteride (D735000), a dual inhibitor of 5α-reductase isoenzymes type 1 and 2.
