A1367912
4-Bromo-3-methoxyaniline , 97% , 19056-40-7
CAS NO.:19056-40-7
Empirical Formula: C7H8BrNO
Molecular Weight: 202.05
MDL number: MFCD05664063
EINECS: 629-064-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100g | RMB1223.20 | In Stock |
|
| 500g | RMB3969.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-100 °C(lit.) |
| Boiling point: | 272.1±20.0 °C(Predicted) |
| Density | 1.531±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.47±0.10(Predicted) |
| form | solid |
| color | Beige |
| BRN | 2690835 |
| InChI | InChI=1S/C7H8BrNO/c1-10-7-4-5(9)2-3-6(7)8/h2-4H,9H2,1H3 |
| InChIKey | RUTNWXBHRAIQSP-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C(OC)=C1 |
| CAS DataBase Reference | 19056-40-7(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-(methyloxy)aniline is a useful reagent for organic synthesis and other chemical processes. It is used in the preparation of 4-Anilino substituted α-carboline compounds as active Brk inhibitors (breast tumor kinase) which are interesting targets for cancer therapy.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H312-H315-H319-H331-H335-H302-H317 |
| Precautionary statements | P261-P304+P340-P305+P351+P338-P405-P501a-P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-43 |
| Safety Statements | 36/37 |
| RIDADR | UN2811 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |







