A1369212
5-Bromo-2-methoxybenzenesulfonyl chloride , 98% , 23095-05-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB41.60 | In Stock |
|
| 5G | RMB134.40 | In Stock |
|
| 25G | RMB502.40 | In Stock |
|
| 100G | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-118 °C (lit.) |
| Boiling point: | 362.3±32.0 °C(Predicted) |
| Density | 1.717 |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 3093014 |
| InChI | 1S/C7H6BrClO3S/c1-12-6-3-2-5(8)4-7(6)13(9,10)11/h2-4H,1H3 |
| InChIKey | IXSBNNRUQYYMRM-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)cc1S(Cl)(=O)=O |
| CAS DataBase Reference | 23095-05-8(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-methoxybenzenesulfonyl chloride may be used in the preparation of the following 1-bromo-3-heteroarylbenzene derivatives:
- 2-(5-bromo-2-methoxyphenyl)benzofuran
- 2-(5-bromo-2-methoxyphenyl)-1-methylpyrrole
- 2-(5-bromo-2-methoxyphenyl)benzoxazole
It may also be used to synthesize N-(4-ethylbenzoyl)-2-methoxybenzenesulfonamide
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29093090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







