A1370112
Benzylhydrazine dihydrochloride , 98% , 20570-96-1
CAS NO.：20570-96-1
Empirical Formula: C7H12Cl2N2
Molecular Weight: 195.09
MDL number: MFCD00012921
EINECS: 243-887-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB212.80 | In Stock |
|
| 100G | RMB646.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-145 °C (dec.)(lit.) |
| Boiling point: | 149.5℃ at 95.5kPa |
| Density | 0.628g/cm3 at 23℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | Slightly yellow to beige |
| Water Solubility | Insoluble in water. |
| BRN | 3688990 |
| InChI | InChI=1S/C7H10N2.2ClH/c8-9-6-7-4-2-1-3-5-7;;/h1-5,9H,6,8H2;2*1H |
| InChIKey | MSJHOJKVMMEMNX-UHFFFAOYSA-N |
| SMILES | N(CC1=CC=CC=C1)N.[H]Cl.[H]Cl |
| Dissociation constant | 0.001-0.001 at 23℃ |
| CAS DataBase Reference | 20570-96-1(CAS DataBase Reference) |
Description and Uses
Benzylhydrazine dihydrochloride is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MU8540000 |
| F | 10 |
| TSCA | Yes |
| HazardClass | 6.1 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29280000 |
| Toxicity | LD50 ipr-mus: 11 mg/kg JMCMAR 18,20,75 |
