A1371712
4-Bromo-1-fluoro-2-nitrobenzene , 98% , 364-73-8
CAS NO.:364-73-8
Empirical Formula: C6H3BrFNO2
Molecular Weight: 220
MDL number: MFCD00129165
EINECS: 639-340-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB40.00 | In Stock |
|
| 100G | RMB127.20 | In Stock |
|
| 500G | RMB523.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 18-19 °C (lit.) |
| Boiling point: | 240-241 °C (lit.) |
| Density | 1.786 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Difficult to mix. |
| form | Liquid After Melting |
| color | Clear yellow to brownish |
| BRN | 2329084 |
| InChI | InChI=1S/C6H3BrFNO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H |
| InChIKey | UQEANKGXXSENNF-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(Br)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 364-73-8(CAS DataBase Reference) |
Description and Uses
Used in the synthesis of anti-inflammatory agents.1
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302-H312-H331 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |







