A1373612
4-Bromo-3-methylbenzonitrile , 98% , 41963-20-6
CAS NO.:41963-20-6
Empirical Formula: C8H6BrN
Molecular Weight: 196.04
MDL number: MFCD00031538
EINECS: 628-521-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB269.60 | In Stock |
|
| 100g | RMB883.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-57 °C (lit.) |
| Boiling point: | 129-130°C 5mm |
| Density | 1.51 |
| Flash point: | 205 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| color | Dark yellow |
| Water Solubility | Insoluble in water. |
| BRN | 2354972 |
| InChI | InChI=1S/C8H6BrN/c1-6-4-7(5-10)2-3-8(6)9/h2-4H,1H3 |
| InChIKey | SKXUZFJOLNNWIG-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Br)C(C)=C1 |
| CAS DataBase Reference | 41963-20-6(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-methylbenzonitrile may be used to synthesize 2,4,6-tris(4-bromo-3-methyl-phenylene)-1,3,5-triazine and 4-fluoro-3-methylbenzonitrile.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |






