A1377012
5-Bromo-2-ethoxypyridine , 98% , 55849-30-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB94.40 | In Stock |
|
| 25G | RMB217.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-36 °C (lit.) |
| Boiling point: | 107°C/33mmHg(lit.) |
| Density | 1.449±0.06 g/cm3(Predicted) |
| Flash point: | 218 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid |
| pka | 1.68±0.22(Predicted) |
| color | Off-white to pale yellow |
| InChI | InChI=1S/C7H8BrNO/c1-2-10-7-4-3-6(8)5-9-7/h3-5H,2H2,1H3 |
| InChIKey | WQXZKMUZWPUZGL-UHFFFAOYSA-N |
| SMILES | C1(OCC)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 55849-30-4(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-ethoxypyridine serves as a precursor for the synthesis of 6,6'-diethoxy-3,3'-bipyridine via nickel-catalyzed coupling[3].
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |






