A1378712
2-?Bromo-?5-?hydroxy-?4-?methoxybenzaldehyde , 90% , 2973-59-3
Synonym(s):
5-Bromoisovanillin
CAS NO.：2973-59-3
Empirical Formula: C8H7BrO3
Molecular Weight: 231.04
MDL number: MFCD00195552
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB238.40 | In Stock |
|
| 100G | RMB824.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100°C |
| Boiling point: | 320.8±37.0 °C(Predicted) |
| Density | 1.653±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0.001Pa at 25-60℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid:particulate/powder |
| pka | 8.69±0.23(Predicted) |
| color | White to Light yellow |
| BRN | 1942858 |
| InChI | InChI=1S/C8H7BrO3/c1-12-8-3-6(9)5(4-10)2-7(8)11/h2-4,11H,1H3 |
| InChIKey | AHYSXUDLJOFNAB-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(O)=C(OC)C=C1Br |
| LogP | 2.2 at 22℃ and pH5 |
| CAS DataBase Reference | 2973-59-3(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-hydroxy-4-methoxybenzaldehyde was used in the synthesis of 4-bromo-2-methoxy-5-(2-methoxyethenyl)phenol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2913000090 |
