A1379512
(S)-(+)-1-Benzyloxy-2-propanol , 97% , 85483-97-2
Synonym(s):
(S)-1-O-Benzylpropylene glycol
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB268.00 | In Stock |
|
| 25g | RMB1174.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 130-132℃ (14 Torr) |
| Density | 1.044 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 228 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 14.46±0.20(Predicted) |
| color | Colorless to Almost colorless |
| optical activity | [α]20/D +14.5°, c = 1 in chloroform |
| InChI | InChI=1S/C10H14O2/c1-9(11)7-12-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | KJBPYIUAQLPHJG-VIFPVBQESA-N |
| SMILES | C(OCC1=CC=CC=C1)[C@@H](O)C |
| CAS DataBase Reference | 85483-97-2 |
Description and Uses
(S)-(+)-1-Benzyloxy-2-propanol can be used as a reactant to prepare:
- (S)-N-(2-phosphonomethoxypropyl) derivatives of purine and pyrimidine bases (PMP derivatives).
- (S)-1-(benzyloxy)propan-2-yl 4-methylbenzenesulfonate by reacting with tosyl chloride in pyridine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 2 |
| HS Code | 2906290090 |






