A5008512
Isoorientin , Analysis of standard products, ≥98% , 4261-42-1
Synonym(s):
Homoorientin;Luteolin 6-C-β-D-glucoside;Luteolin 6-C-glucoside
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB703.20 | In Stock |
|
| 20mg | RMB732.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-246°C |
| Boiling point: | 856.7±65.0 °C(Predicted) |
| Density | 1.759±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | methanol: soluble5mg/mL, clear, colorless to yellow |
| form | powder |
| pka | 5.90±0.40(Predicted) |
| color | yellow |
| biological source | leaves (Phyllostachya Nigra) |
| Stability: | Hygroscopic |
| InChIKey | ODBRNZZJSYPIDI-VJXVFPJBSA-N |
| SMILES | C1(C(O)=CC2OC(C3C=CC(O)=C(O)C=3)=CC(=O)C=2C=1O)[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:21,22,24,25,27,r| |
| LogP | 1.580 (est) |
Description and Uses
Reference Standard in the analysis of herbal medicinal products
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29389090 |





