A1380112
1-Bromo-4-fluoronaphthalene , 98% , 341-41-3
CAS NO.:341-41-3
Empirical Formula: C10H6BrF
Molecular Weight: 225.06
MDL number: MFCD00051473
EINECS: 206-434-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25G | RMB340.00 | In Stock |
|
| 100G | RMB1092.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-38 °C (lit.) |
| Boiling point: | 110-115 °C(Press: 2 Torr) |
| Density | 1.563±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| color | White |
| BRN | 2085804 |
| InChI | InChI=1S/C10H6BrF/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H |
| InChIKey | VAUJZKBFENPOCH-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2)=C(F)C=C1 |
| CAS DataBase Reference | 341-41-3(CAS DataBase Reference) |
Description and Uses
1-Bromo-4-fluoronaphthalene is the starting material for the synthesis of Fluorobenzo[c]fluoren (F588435) which is a polycyclic aromatic hydrocarbon used in materials science extensively due to utility in organic electronics, light emitting diodes and solar cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





