A1381312
4-Benzyloxybromobenzene , 98% , 6793-92-6
CAS NO.：6793-92-6
Empirical Formula: C13H11BrO
Molecular Weight: 263.13
MDL number: MFCD00028016
EINECS: 614-179-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100g | RMB246.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-63 °C (lit.) |
| Boiling point: | 166-167 °C/4 mmHg (lit.) |
| Density | 1.3883 (rough estimate) |
| refractive index | 1.5130 (estimate) |
| Flash point: | 166-167°C/3mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly, Heated) |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 1371040 |
| InChI | InChI=1S/C13H11BrO/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | OUQSGILAXUXMGI-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(OCC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 6793-92-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Benzyloxybromobenzene(6793-92-6) |
Description and Uses
1-Benzyloxy-4-Bromobenzene is used in preparation of arylalkenylpropargylamine derivatives as MAO-B inhibitors exhibiting neuroprotective action for treatment of neurodegenerative diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29093090 |
| Storage Class | 11 - Combustible Solids |
