A1382312
2-Bromo-2′,4′-dichloroacetophenone , >98.0%(GC) , 2631-72-3
CAS NO.：2631-72-3
Empirical Formula: C8H5BrCl2O
Molecular Weight: 267.93
MDL number: MFCD00053005
EINECS: 220-116-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB84.80 | In Stock |
|
| 5G | RMB338.40 | In Stock |
|
| 25G | RMB697.60 | In Stock |
|
| 100G | RMB2623.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-29 °C(lit.) |
| Boiling point: | 103-106 °C(Press: 0.4 Torr) |
| Density | 1.695±0.06 g/cm3(Predicted) |
| refractive index | 1.60 |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Methanol |
| form | Low Melting Solid |
| color | White to brown |
| Sensitive | Lachrymatory |
| InChI | InChI=1S/C8H5BrCl2O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3H,4H2 |
| InChIKey | DASJDMQCPIDJIF-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Cl)C=C1Cl)CBr |
| CAS DataBase Reference | 2631-72-3(CAS DataBase Reference) |
Description and Uses
2-Bromo-2',4'-dichloroacetophenone is a metabolite of the insecticide Bromfenvinphos. It is also a useful intermediate in the preparation of substituted acetophenone derivatives.
Safety
| Symbol(GHS) |   GHS06,GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314-H301-H315-H318-H335 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P501a-P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P261-P280-P301+P310-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29147000 |
