A1389012
4-Bromocatechol , ≥98.0% , 17345-77-6
CAS NO.：17345-77-6
Empirical Formula: C6H5BrO2
Molecular Weight: 189.01
MDL number: MFCD00869769
EINECS: 241-370-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB97.60 | In Stock |
|
| 5G | RMB352.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87 °C |
| Boiling point: | 280.5±20.0 °C(Predicted) |
| Density | 1.844±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO |
| form | Solid |
| pka | 8.84±0.10(Predicted) |
| color | Brown |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C6H5BrO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H |
| InChIKey | AQVKHRQMAUJBBP-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C=C1O |
Description and Uses
A type of human dopamine sulfotransferase, belonging to the catechol family of molecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-24/25 |
| HS Code | 29081990 |
