A1391612
2,2′-Bipyrimidine , 96% , 34671-83-5
Synonym(s):
2,2′-Dipyrimidyl
CAS NO.：34671-83-5
Empirical Formula: C8H6N4
Molecular Weight: 158.16
MDL number: MFCD00014600
EINECS: 252-137-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB100.80 | In Stock |
|
| 1G | RMB290.40 | In Stock |
|
| 5G | RMB1166.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-116 °C(lit.) |
| Boiling point: | 395.4±25.0 °C(Predicted) |
| Density | 1.239 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | -1.22±0.33(Predicted) |
| color | White to Green to Brown |
| BRN | 607396 |
| InChI | InChI=1S/C8H6N4/c1-3-9-7(10-4-1)8-11-5-2-6-12-8/h1-6H |
| InChIKey | HKOAFLAGUQUJQG-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC=N2)=NC=CC=N1 |
| CAS DataBase Reference | 34671-83-5(CAS DataBase Reference) |
Description and Uses
2,2'-Bipyrimidine is used in the preparation of 5-bromo-[2,2']bipyrimidinyl.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29335990 |
