A1393312
N-Boc-cis-4-hydroxy-L-proline methyl ester , >97.0% , 102195-79-9
CAS NO.：102195-79-9
Empirical Formula: C11H19NO5
Molecular Weight: 245.27
MDL number: MFCD00237541
EINECS: 627-146-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB83.20 | In Stock |
|
| 25G | RMB242.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-86 °C (lit.) |
| Boiling point: | 335.2±42.0 °C(Predicted) |
| Density | 1.216±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | powder to crystal |
| pka | 14.27±0.40(Predicted) |
| color | White to Almost white |
| optical activity | -63.6200°(C=1.011g/100ml ETOH) |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C11H19NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h7-8,13H,5-6H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | SVSSZFBZFUSINI-SFYZADRCSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@@H](O)C[C@H]1C(OC)=O |
| CAS DataBase Reference | 102195-79-9(CAS DataBase Reference) |
Description and Uses
Used as a local anaesthetic. Used as therapeutic agents. Employed as important intermediates in various areas such as peptide synthesis, polymer chemistry..
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| HS Code | 29339900 |
