A6245212
N-Boc-cis-4-hydroxy-L-proline , 97% , 87691-27-8
Synonym(s):
N-Boc-cis-4-hydroxypyrrolidine-2-carboxylic acid
CAS NO.:87691-27-8
Empirical Formula: C10H17NO5
Molecular Weight: 231.25
MDL number: MFCD02094406
EINECS: 627-315-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB32.24 | In Stock |
|
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB200.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146 °C (D) (lit.) |
| alpha | -50 º (c=0.67, MeOH) |
| Boiling point: | 390.9±42.0 °C(Predicted) |
| Density | 1.312±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.80±0.40(Predicted) |
| form | Powder or Crystalline Powder |
| color | White to off-white |
| optical activity | [α]20/D -50.0±3°, c = 0.67 in methanol |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H17NO5/c1-10(2,3)16-9(15)11-5-6(12)4-7(11)8(13)14/h6-7,12H,4-5H2,1-3H3,(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | BENKAPCDIOILGV-BQBZGAKWSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@@H](O)C[C@H]1C(O)=O |
| CAS DataBase Reference | 87691-27-8(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50 |
| Safety Statements | 26-36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |








