A1394012
5-Bromo-2-methylbenzonitrile , 97% , 156001-51-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.56 | In Stock |
|
| 5G | RMB84.80 | In Stock |
|
| 25G | RMB294.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-51 °C |
| Boiling point: | 251℃ |
| Density | 1.51 |
| Flash point: | 110 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C8H6BrN/c1-6-2-3-8(9)4-7(6)5-10/h2-4H,1H3 |
| InChIKey | WNVUTFDOGUGEIS-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(Br)=CC=C1C |
Description and Uses
2-Hydroxy-6-methyl-5-nitropyridine is a versatile building block that can be used to create a range of compounds, such as 5-Bromo-2-methylbenzaldehyde, 1-(5-Bromo-2-methylphenyl)ethanone, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H301+H311+H331-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P361+P364-P332+P313-P301+P310+P330-P302+P352+P312-P304+P340+P311-P403+P233-P405 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | UN 3439 6.1/PG III |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
