A1395812
Benzyl (S,S,S)-2-azabicyclo[3.3.0]octane-3-carboxylate hydrochloride , 97% , 87269-87-2
Synonym(s):
(S,S,S)-2-Azabicyclo-[3,3,0]-octane carboxylic acid benzylester hydrochloride;(S,S,S)-2-Azabicyclo[3,3,0]octane-3-carboxylic acid benzyl ester hydrochloride
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB133.60 | In Stock |
|
| 25G | RMB438.40 | In Stock |
|
| 100g | RMB1582.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-180 °C(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly, Heated), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D -26°, c = 1% in DMSO |
| Stability: | Hygroscopic |
| InChI | 1S/C15H19NO2.ClH/c17-15(18-10-11-5-2-1-3-6-11)14-9-12-7-4-8-13(12)16-14;/h1-3,5-6,12-14,16H,4,7-10H2;1H/t12-,13-,14-;/m0./s1 |
| InChIKey | HLXCXOQXUDRJLF-JKBZPBJLSA-N |
| SMILES | Cl[H].[H][C@@]12CCC[C@]1([H])N[C@@H](C2)C(=O)OCc3ccccc3 |
Description and Uses
Benzyl (S,S,S)-2-azabicyclo[3.3.0]octane-3-carboxylate hydrochloride can be used:
- In the preparation of ramipril, an angiotensin-converting enzyme (ACE) inhibitor.
- As a starting material for the synthesis of octahydrocyclopenta[b]pyrrole-2-carbonitrile derivatives as potent DPP4 inhibitors.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS02 |
| Signal word | Danger |
| Hazard statements | H304-H413-H225 |
| Precautionary statements | P501-P273-P240-P210-P233-P243-P241-P242-P280-P370+P378-P331-P303+P361+P353-P301+P310-P403+P235-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HS Code | 2933.99.9701 |
| Storage Class | 11 - Combustible Solids |

![Benzyl (S,S,S)-2-azabicyclo[3.3.0]octane-3-carboxylate hydrochloride](https://img.chemicalbook.com/CAS/GIF/87269-87-2.gif)



