A1396612
4-(Benzyloxy)pyridine N-oxide , 98% , 2683-66-1
CAS NO.:2683-66-1
Empirical Formula: C12H11NO2
Molecular Weight: 201.22
MDL number: MFCD00047427
EINECS: 627-629-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB85.68 | In Stock |
|
| 5G | RMB318.96 | In Stock |
|
| 25G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-179 °C (dec.)(lit.) |
| Boiling point: | 415.3±20.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| pka | 2.25±0.10(Predicted) |
| BRN | 165005 |
| InChI | 1S/C12H11NO2/c14-13-8-6-12(7-9-13)15-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | SUSQPKJQYWTFPU-UHFFFAOYSA-N |
| SMILES | [O-][n+]1ccc(OCc2ccccc2)cc1 |
| CAS DataBase Reference | 2683-66-1(CAS DataBase Reference) |
Description and Uses
4-Benzyloxypyridine N-Oxide is an intermediate in the synthesis of 4-Hydroxy-1-methyl-2-pyridone (H947715), a reactant used in the synthesis of 3-deaza-3-halouracil nucleosides with cytostatic activity in three cancer cell lines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





