A1396712
2-Bromo-4,5-difluorophenol , 98% , 166281-37-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.40 | In Stock |
|
| 5G | RMB202.40 | In Stock |
|
| 25G | RMB879.20 | In Stock |
|
| 100G | RMB3359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 208.8±35.0 °C(Predicted) |
| Density | 1.829 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 178 °F |
| storage temp. | Store at room temperature |
| form | clear liquid |
| pka | 7.46±0.23(Predicted) |
| color | Colorless to Yellow |
| BRN | 8355005 |
| InChI | InChI=1S/C6H3BrF2O/c7-3-1-4(8)5(9)2-6(3)10/h1-2,10H |
| InChIKey | FCYZOOHWUOEAOX-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=C(F)C=C1Br |
| CAS DataBase Reference | 166281-37-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29081990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
