A1396912
4-Bromo-3-methylphenol , >98.0%(GC) , 14472-14-1
Synonym(s):
4-Bromo-m-cresol
CAS NO.:14472-14-1
Empirical Formula: C7H7BrO
Molecular Weight: 187.03
MDL number: MFCD00079723
EINECS: 238-464-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB36.80 | In Stock |
|
| 25G | RMB141.60 | In Stock |
|
| 100G | RMB460.00 | In Stock |
|
| 250g | RMB935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-61 °C (lit.) |
| Boiling point: | 142-145 °C/23 mmHg (lit.) |
| Density | 1.3839 (rough estimate) |
| refractive index | 1.5772 (estimate) |
| Flash point: | 142-145°C/23mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder or Chunks |
| pka | 9.51±0.18(Predicted) |
| color | White to off-white |
| BRN | 1859122 |
| InChI | InChI=1S/C7H7BrO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| InChIKey | GPOQODYGMUTOQL-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C(C)=C1 |
| CAS DataBase Reference | 14472-14-1(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-methylphenol may be used in the synthesis of bromo[2-methyl-4-[2-(t-butyldimethylsilyloxy)ethyloxy]phenyl]bis(triphenylphopshine)nickel(II) (protected alcohol-functionalized initiator) and bromo-[2-methyl-4-[6-(t-butyldimethylsilyloxy)hexyloxy]phenyl] bis(triphenylphosphine) nickel.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




