A1397312
4-Bromobenzotrifluoride , 98% , 402-43-7
Synonym(s):
1-Bromo-4-(trifluoromethyl)benzene;4-Bromo-α,α,α-trifluorotoluene
CAS NO.:402-43-7
Empirical Formula: C7H4BrF3
Molecular Weight: 225.01
MDL number: MFCD00000398
EINECS: 206-943-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB187.20 | In Stock |
|
| 250g | RMB303.20 | In Stock |
|
| 500G | RMB580.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 154-155 °C(lit.) |
| Density | 1.607 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 120 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Not miscible or difficult to mix. |
| form | Liquid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.607 |
| BRN | 2045666 |
| InChI | InChI=1S/C7H4BrF3/c8-6-3-1-5(2-4-6)7(9,10)11/h1-4H |
| InChIKey | XLQSXGGDTHANLN-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C(F)(F)F)C=C1 |
| CAS DataBase Reference | 402-43-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-4-(trifluoromethyl)-(402-43-7) |
| EPA Substance Registry System | Benzene, 1-bromo-4-(trifluoromethyl)- (402-43-7) |
Description and Uses
4-Bromobenzotrifluoride was used to study the catalytic activity of palladacycle using Suzuki-Miyaura reaction.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F,Xn |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36-37/39-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








