A6735312
4-Pentylbromobenzene , 97% , 51554-95-1
Synonym(s):
1-Bromo-4-pentylbenzene
CAS NO.:51554-95-1
Empirical Formula: C11H15Br
Molecular Weight: 227.14
MDL number: MFCD00061113
EINECS: 472-220-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB212.00 | In Stock |
|
| 500g | RMB843.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 203-204 °C (lit.) |
| Density | 1.272 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 192 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Clear Colorless |
| Specific Gravity | 1.21 |
| InChI | InChI=1S/C11H15Br/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9H,2-5H2,1H3 |
| InChIKey | SGCJPYYTVBHQGE-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(CCCCC)C=C1 |
| CAS DataBase Reference | 51554-95-1(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H318-H410 |
| Precautionary statements | P264-P273-P280-P302+P352-P305+P351+P338-P332+P313 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26-37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 |








