A1398812
2-Bromo-4-(trifluoromethyl)pyridine , 97% , 175205-81-9
CAS NO.:175205-81-9
Empirical Formula: C6H3BrF3N
Molecular Weight: 225.99
MDL number: MFCD00153085
EINECS: 672-057-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB142.40 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100g | RMB2383.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -21--20 °C |
| Boiling point: | 84-85 °C/14 mmHg |
| Density | 1.827 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 164 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | -1.57±0.10(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H3BrF3N/c7-5-3-4(1-2-11-5)6(8,9)10/h1-3H |
| InChIKey | WZVHLUMAQLUNTJ-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 175205-81-9(CAS DataBase Reference) |
Description and Uses
Regioselective deprotonation at C-3 with LDA followed by trapping with carbon dioxide provides the correspondin nicotinic acid.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38-37/38-36 |
| Safety Statements | 26-36/37-45-37 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






