A1400712
2-Bromo-4-fluoroaniline , ≥98.0% , 1003-98-1
CAS NO.:1003-98-1
Empirical Formula: C6H5BrFN
Molecular Weight: 190.01
MDL number: MFCD00042462
EINECS: 619-469-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB56.00 | In Stock |
|
| 100G | RMB162.40 | In Stock |
|
| 500g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41 |
| Boiling point: | 221 °C (lit.) |
| Density | 1.67 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 220 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Liquid |
| pka | 2.60±0.10(Predicted) |
| color | Clear yellow-brown |
| Specific Gravity | 1.670 |
| BRN | 2802562 |
| InChI | InChI=1S/C6H5BrFN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2 |
| InChIKey | YLMFXCIATJJKQL-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C=C1Br |
| CAS DataBase Reference | 1003-98-1(CAS DataBase Reference) |
Description and Uses
2-Bromo-4-fluoroaniline is an organic compound that is an aniline derivative. It is mainly used as an organic synthesis reagent in experimental research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






