A1401912
2-Bromo-4-methylphenol , >98.0%(GC) , 6627-55-0
Synonym(s):
2-Bromo-p-cresol
CAS NO.:6627-55-0
Empirical Formula: C7H7BrO
Molecular Weight: 187.03
MDL number: MFCD00002151
EINECS: 229-595-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB115.20 | In Stock |
|
| 100G | RMB388.00 | In Stock |
|
| 500G | RMB1751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-55 °C |
| Boiling point: | 245-247 °C |
| Density | 1.554±0.06 g/cm3 | Condition: Temp: 20 °C Press: 760 Torr |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Chloroform, Methanol |
| form | powder to lump to clear liquid |
| pka | 8.73±0.18(Predicted) |
| color | White or Colorless to Light yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H7BrO/c1-5-2-3-7(9)6(8)4-5/h2-4,9H,1H3 |
| InChIKey | MTIDYGLTAOZOGU-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C)C=C1Br |
| CAS DataBase Reference | 6627-55-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 2-bromo-4-methyl-(6627-55-0) |
| EPA Substance Registry System | Phenol, 2-bromo-4-methyl- (6627-55-0) |
Description and Uses
It is applied as a compound responsible for iodine off-flavor in wines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-21/22 |
| Safety Statements | 26-37/39-36/37/39-24/25 |
| WGK Germany | 3 |
| RTECS | GO6868200 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29071990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




