A1402012
2-(Boc-amino)-5-bromopyridine , 97% , 159451-66-8
CAS NO.：159451-66-8
Empirical Formula: C10H13BrN2O2
Molecular Weight: 273.13
MDL number: MFCD06411381
| Pack Size | Price | Stock | Quantity |
| 5G | RMB239.20 | In Stock |
|
| 25G | RMB1090.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-171 °C(lit.) |
| Boiling point: | 288.2±25.0 °C(Predicted) |
| Density | 1.453±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 11.68±0.70(Predicted) |
| form | solid |
| color | Off-white |
| InChI | InChI=1S/C10H13BrN2O2/c1-10(2,3)15-9(14)13-8-5-4-7(11)6-12-8/h4-6H,1-3H3,(H,12,13,14) |
| InChIKey | CKXAMCSVTNPSCZ-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1=NC=C(Br)C=C1 |
Description and Uses
2-(Boc-amino)-5-bromopyridine is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research. It could be used to sythesize 2-(tert-Butoxycarbonylamino)pyridine-5-carboxaldehyde.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933399990 |
