A1402712
2-Bromobenzyl bromide , 98% , 3433-80-5
Synonym(s):
α,2-Dibromotoluene
CAS NO.:3433-80-5
Empirical Formula: C7H6Br2
Molecular Weight: 249.93
MDL number: MFCD00000173
EINECS: 222-334-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 10G | RMB47.20 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 100G | RMB219.20 | In Stock |
|
| 250G | RMB492.80 | In Stock |
|
| 500G | RMB920.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 29-32 °C (lit.) |
| Boiling point: | 129 °C/19 mmHg (lit.) |
| Density | 1.8246 (rough estimate) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | dioxane: soluble1g/10 mL, clear, colorless |
| form | Liquid After Melting |
| color | Clear colorless to yellow |
| Water Solubility | Insoluble in water. |
| BRN | 971015 |
| InChI | InChI=1S/C7H6Br2/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| InChIKey | LZSYGJNFCREHMD-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC=C1CBr |
| CAS DataBase Reference | 3433-80-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-2-(bromomethyl)-(3433-80-5) |
| EPA Substance Registry System | 2-Bromobenzyl bromide (3433-80-5) |
Description and Uses
2-Bromobenzyl bromide was used in the synthesis of:
- substituted quinazolines and 1,2,3,4-tetrahydroquinazolines
- 2- and 3-substituted indenes
- tris-2-bromotribenzylamine
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,T |
| Risk Statements | 34-37-23 |
| Safety Statements | 26-36/37/39-45-22 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| F | 8-19 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





