A1403612
5-Bromoindoline , ≥98.0% , 22190-33-6
CAS NO.:22190-33-6
Empirical Formula: C8H8BrN
Molecular Weight: 198.06
MDL number: MFCD00027410
EINECS: 629-063-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB157.60 | In Stock |
|
| 25G | RMB612.00 | In Stock |
|
| 100g | RMB2108.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-40 °C (lit.) |
| Boiling point: | 114-115°C 5mm |
| Density | 1.5240 g/cm3 |
| refractive index | 1.63 |
| Flash point: | >230 °F |
| storage temp. | -20°C |
| solubility | DMSO, Methanol |
| pka | 4.35±0.20(Predicted) |
| form | Solid |
| color | Off-White |
| BRN | 121590 |
| InChI | InChI=1S/C8H8BrN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,5,10H,3-4H2 |
| InChIKey | QEDCHCLHHGGYBT-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C=C2)CC1 |
| CAS DataBase Reference | 22190-33-6(CAS DataBase Reference) |
Description and Uses
5-Bromoindoline is a brominated indoline derivative and a product of biocatalyzed halogenation of nucleobase analogs. 5-Bromoindoline is used in the synthetic preparation of biologically active compou nds such as selective human β3 adrenergic receptor agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







