A1413412
Bifonazole , ≥98%(HPLC) , 60628-96-8
Synonym(s):
1-(p,α-Diphenylbenzyl)imidazole;Bifonazole
CAS NO.:60628-96-8
Empirical Formula: C22H18N2
Molecular Weight: 310.4
MDL number: MFCD00865567
EINECS: 262-336-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB76.00 | In Stock |
|
| 25G | RMB120.00 | In Stock |
|
| 100g | RMB366.40 | In Stock |
|
| 500g | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142℃ |
| Boiling point: | 440.55°C (rough estimate) |
| Density | 1.1150 (rough estimate) |
| refractive index | 1.7620 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO |
| form | powder |
| pka | 6.55±0.22(Predicted) |
| color | white to off-white |
| Merck | 14,1213 |
| Cosmetics Ingredients Functions | ANTI-SEBORRHEIC ANTIMICROBIAL |
| InChI | InChI=1S/C22H18N2/c1-3-7-18(8-4-1)19-11-13-21(14-12-19)22(24-16-15-23-17-24)20-9-5-2-6-10-20/h1-17,22H |
| InChIKey | OCAPBUJLXMYKEJ-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(N1C=NC=C1)C1C=CC(C2C=CC=CC=2)=CC=1 |
| LogP | 4.770 |
| CAS DataBase Reference | 60628-96-8(CAS DataBase Reference) |
Description and Uses
Bifonazole represents the first topical broad spectrum antimycotic approved for once daily administration. Its in vitro activity appears equivalent to its structural relative clotrimazole, being effective against dermatophytes, other filamentous fungi, dimorphic fungi and yeasts.
antibacterial
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 1 |
| RTECS | NI3517000 |
| HS Code | 29332900 |
| Toxicity | LD50 in male mice, rats (mg/kg): 2629, 2854 orally (Schlüter) |




![[1,1'-Biphenyl]-4-yl(phenyl)methanol](https://img.chemicalbook.com/CAS/GIF/7598-80-3.gif)
