A1413812
Beclomethasone dipropionate , ≥98.0%(HPLC) , 5534-09-8
CAS NO.:5534-09-8
Empirical Formula: C28H37ClO7
Molecular Weight: 521.04
MDL number: MFCD00135613
EINECS: 226-886-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB159.20 | In Stock |
|
| 1G | RMB319.20 | In Stock |
|
| 5G | RMB719.20 | In Stock |
|
| 25g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-120 C |
| alpha | D +98.0° (c = 1.0 in dioxane) |
| Boiling point: | 613.3°C (rough estimate) |
| Density | 1.0766 (rough estimate) |
| refractive index | 1.4429 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Dioxane (Slightly, Sonicated), Methanol (Slightly, Heated |
| form | Solid |
| pka | 13.02±0.70(Predicted) |
| color | White |
| optical activity | 84.3°(C=0.01 g/ml,1,4-dioxane, 20°C, 589nm) |
| λmax | 238nm(EtOH)(lit.) |
| Merck | 14,1019 |
| Major Application | forensics and toxicology veterinary |
| InChIKey | KUVIULQEHSCUHY-NHOFSDNKNA-N |
| SMILES | [C@@]1(OC(=O)CC)(C(=O)COC(=O)CC)[C@@H](C)C[C@@]2([H])[C@]3([H])CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]12C |&1:0,14,17,19,29,31,33,36,r| |
| CAS DataBase Reference | 5534-09-8(CAS DataBase Reference) |
Description and Uses
Beclomethasone dipropionate is a topically active corticosteroid used as an adjuvant in the control of chronic asthma when given by inhalation as an aerosol. It is also used as a topical anti-inflammatory.
Safety
| Symbol(GHS) | ![]() ![]() GHS07 ,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H350-H360 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Adrenal gland,Immune system,Bone |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn |
| Risk Statements | 60-61-36/37/38-20/21/22 |
| Safety Statements | 53-36/37/39-45-36-26 |
| WGK Germany | 3 |
| RTECS | TU3805000 |
| HS Code | 29372100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 STOT RE 2 |
| Toxicity | LD50 oral in rat: > 3750mg/kg |








