A1383212
Betamethasone 17,21-Dipropionate , ≥97.0% , 5593-20-4
Synonym(s):
9α-Fluoro-16β-methyl-11β,17α,21-trihydroxy-1,4-pregnadiene-3,20-dione 17,21-dipropionate;Betamethasone 17,21-dipropionate
CAS NO.:5593-20-4
Empirical Formula: C28H37FO7
Molecular Weight: 504.6
MDL number: MFCD00133140
EINECS: 227-005-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB319.20 | In Stock |
|
| 5G | RMB1192.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178 °C |
| alpha | D26 +65.7° (dioxane) |
| Boiling point: | 603.2±55.0 °C(Predicted) |
| Density | 1.1481 (estimate) |
| refractive index | 69 ° (C=1, Dioxane) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, freely soluble in acetone and in methylene chloride, sparingly soluble in ethanol (96 per cent). |
| form | Solid |
| pka | 12.87±0.70(Predicted) |
| color | White to Pale Yellow |
| Merck | 1180 |
| InChIKey | CIWBQSYVNNPZIQ-JCOVECCMSA-N |
| SMILES | C([C@]1([C@H](C[C@@]2([H])[C@]3([H])CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C)C)OC(=O)CC)(=O)COC(=O)CC |&1:1,2,4,6,16,18,20,23,r| |
| CAS DataBase Reference | 5593-20-4(CAS DataBase Reference) |
Description and Uses
Cortico Steroids
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360FD-H373 |
| Precautionary statements | P202-P260-P280-P308+P313-P405-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | TU4058000 |
| HS Code | 29372290 |
| Toxicity | LD50 ipr-mus: 103 mg/kg NIIRDN 6,753,82 |





