A0672656
Betamethasonesolutionstandardsubstanceinmethanol , 100mg/L in methanol
Synonym(s):
9α-Fluoro-11β,17α,21-trihydroxy-16β-methylpregna-1,4-diene-3,20-dione;9α-Fluoro-16β-methyl-11β,17α,21-trihydroxy-1,4-pregnadiene-3,20-dione;9α-Fluoro-16β-methylprednisolone;Betamethasone;Betamethasone valerate impurity A (PhEur)
CAS NO.:
Empirical Formula: C22H29FO5
Molecular Weight: 392.47
MDL number: MFCD00062969
EINECS: 206-825-4
| Pack Size | Price | Stock | Quantity |
| 1.2ml | RMB183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 235-237°C |
| alpha | D +108° (acetone) |
| Boiling point: | 568.2±50.0 °C(Predicted) |
| Density | 1.1283 (estimate) |
| refractive index | 118 ° (C=1, Dioxane) |
| storage temp. | 0-6°C |
| solubility | Practically insoluble in water, sparingly soluble in anhydrous ethanol, very slightly soluble in methylene chloride. |
| form | Solid |
| pka | 12.13±0.70(Predicted) |
| color | White to Off-White |
| biological source | synthetic (organic) |
| Water Solubility | 58mg/L(25 ºC) |
| Merck | 14,1180 |
| InChIKey | UREBDLICKHMUKA-DVTGEIKXSA-N |
| SMILES | [H][C@@]12C[C@H](C)[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]3(F)[C@@]2([H])CCC4=CC(=O)C=C[C@]34C |
| LogP | 2.01 at 25℃ |
| CAS DataBase Reference | 378-44-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Pregna-1,4-diene-3,20-dione, 9alpha-fluoro-11beta,17alpha,21-trihydroxy-16beta-methyl-(378-44-9) |
| EPA Substance Registry System | Pregna-1,4-diene-3,20-dione, 9-fluoro-11,17,21-trihydroxy-16-methyl-, (11.beta.,16.beta.)- (378-44-9) |
Description and Uses
Betamethasone is a synthetic corticosteroid. Like other corticosteroids, betamethasone has anti-inflammatory actions. Betamethasone also accelerates fetal lung maturation and has been used to decrease neonatal mortality and morbidity in infants born before 34 weeks of gestation.
anti-inflammatory, immunosuppressive
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360FD-H373 |
| Precautionary statements | P202-P260-P280-P308+P313-P405-P501 |
| target organs | Liver,Kidney,Endocrine system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn,T |
| Risk Statements | 40-48/20/21-61 |
| Safety Statements | 22-36-45-53 |
| WGK Germany | 2 |
| RTECS | TU4000000 |
| HS Code | 29379000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B STOT RE 2 |
| Hazardous Substances Data | 378-44-9(Hazardous Substances Data) |
| Toxicity | LD50 oral in mouse: > 4500mg/kg |






