A1425612
betamethasone 21-phosphate sodium , ≥97% , 151-73-5
Synonym(s):
Betamethasone 21-phosphate disodium;Betamethasone disodium phosphate;Betamethasone sodium phosphate
CAS NO.:151-73-5
Empirical Formula: C22H28FNa2O8P
Molecular Weight: 516.4
MDL number: MFCD00200361
EINECS: 205-797-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB44.00 | In Stock |
|
| 1G | RMB100.00 | In Stock |
|
| 5g | RMB384.00 | In Stock |
|
| 25g | RMB1228.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206-211°C |
| alpha | +98.0~+104.0°(D/20℃)(c=1,H2O) (calculated on the dehydrous basis) |
| storage temp. | room temp |
| solubility | Freely soluble in water, slightly soluble in ethanol (96 per cent), practically insoluble in methylene chloride. |
| form | Solid |
| color | White to Off-White |
| PH | 7.5~9.0(5g/l, 25℃) |
| Water Solubility | water: 50mg/mL, clear to very slightly hazy, faintly yellow |
| Merck | 14,1180 |
| Stability: | Hygroscopic |
| InChIKey | PLCQGRYPOISRTQ-LWCNAHDDSA-L |
| SMILES | [C@@]12([H])C[C@H](C)[C@](O)(C(=O)COP([O-])([O-])=O)[C@@]1(C)C[C@H](O)[C@]1(F)[C@@]3(C)C=CC(=O)C=C3CC[C@@]21[H].[Na+].[Na+] |&1:0,3,5,15,18,20,22,32,r| |
| EPA Substance Registry System | .beta.-Methasone disodium phosphate (151-73-5) |
Description and Uses
Nasal, Ophthalmic, Oral, Parenteral
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H360FD-H373 |
| Precautionary statements | P202-P260-P264-P270-P301+P312-P308+P313 |
| target organs | Liver,Kidney,Endocrine system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | TU4056500 |
| HS Code | 29372290 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 1B STOT RE 2 |
| Toxicity | LD50 orl-rat: 1877 mg/kg DRUGAY -,1075,90 |







