A1414312
Bezafibrate , ≥98% , 41859-67-0
Synonym(s):
2-[4-[2-(4-Chlorobenzamido)ethyl]phenoxy]-2-methylpropanoic acid
CAS NO.:41859-67-0
Empirical Formula: C19H20ClNO4
Molecular Weight: 361.82
MDL number: MFCD00078970
EINECS: 255-567-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB69.60 | In Stock |
|
| 5G | RMB126.40 | In Stock |
|
| 25G | RMB448.00 | In Stock |
|
| 100G | RMB1414.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184 °C |
| Boiling point: | 572.1±45.0 °C(Predicted) |
| Density | 1.260±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: soluble |
| form | solid |
| pka | 3.29±0.10(Predicted) |
| color | White to Off-White |
| Merck | 14,1195 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C19H20ClNO4/c1-19(2,18(23)24)25-16-9-3-13(4-10-16)11-12-21-17(22)14-5-7-15(20)8-6-14/h3-10H,11-12H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IIBYAHWJQTYFKB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(OC1=CC=C(CCNC(=O)C2=CC=C(Cl)C=C2)C=C1)(C)C |
| LogP | 2.504 (est) |
| CAS DataBase Reference | 41859-67-0(CAS DataBase Reference) |
| EPA Substance Registry System | Propanoic acid, 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methyl- (41859-67-0) |
Description and Uses
Bezafibrate is a non-selective agonist of peroxisome proliferator-activated receptors (PPARs; EC50s = 50, 60, and 20 μM for human PPARα, PPARγ, and PPARδ, respectively). It reduces triglyceride levels and the size of lipid droplets in an oleic acid-induced HepaRG hepatocyte model of steatosis when used at a concentration of 25 μM. Bezafibrate (10 mg/kg per day) reduces plasma VLDL and LDL mass and triglyceride and free fatty acid levels in a high-fructose plus lard diet-induced rat model of insulin resistance.
anti-hyperlipoproteinemic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 1 |
| RTECS | UE8755000 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | LD50 oral in rat: 1082mg/kg |





