BD4652941
4-Chloro-N-(4-hydroxyphenethyl)benzamide , 98% , 41859-57-8
CAS NO.：41859-57-8
Empirical Formula: C15H14ClNO2
Molecular Weight: 275.73
MDL number: MFCD00218513
EINECS: 255-566-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB72.80 | In Stock |
|
| 5g | RMB220.80 | In Stock |
|
| 10g | RMB417.60 | In Stock |
|
| 25g | RMB835.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-1720C |
| Boiling point: | 505.4±40.0 °C(Predicted) |
| Density | 1.268±0.06 g/cm3(Predicted) |
| RTECS | CV2450481 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.01±0.15(Predicted) |
| color | Pale Red to Light Brown |
| InChI | 1S/C15H14ClNO2/c16-13-5-3-12(4-6-13)15(19)17-10-9-11-1-7-14(18)8-2-11/h1-8,18H,9-10H2,(H,17,19) |
| InChIKey | ZTLWJYCDAXUIBK-UHFFFAOYSA-N |
| SMILES | ClC1=CC=C(C(NCCC2=CC=C(O)C=C2)=O)C=C1 |
| CAS DataBase Reference | 41859-57-8(CAS DataBase Reference) |
Description and Uses
Intermediate in the preparation of Bezafibrate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2924.29.7790 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
| REACH Registrations | Active |
