A1424412
Boc-Phe(3-CF3)-OH , ≥98% , 142995-31-1
Synonym(s):
Boc-3-(trifluoromethyl)-L -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB404.00 | In Stock |
|
| 5G | RMB1424.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-138 °C |
| Boiling point: | 423.2±45.0 °C(Predicted) |
| Density | 1.271±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.79±0.10(Predicted) |
| form | Solid |
| optical activity | [α]20/D +7.3±0.5°, c = 1% in methanol |
| BRN | 7048145 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H18F3NO4/c1-14(2,3)23-13(22)19-11(12(20)21)8-9-5-4-6-10(7-9)15(16,17)18/h4-7,11H,8H2,1-3H3,(H,19,22)(H,20,21)/t11-/m0/s1 |
| InChIKey | SHMWDGGGZHFFRC-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cccc(c1)C(F)(F)F)C(O)=O |
| CAS DataBase Reference | 142995-31-1(CAS DataBase Reference) |
Description and Uses
Boc-L-3-Trifluoromethylphenylalanine (Boc-Phe(3-CF3)-OH) is a phenylalanine derivative that can be used in peptide synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |
