A1424712
Boc-4-phenyl-Phe-OH , 98% , 147923-08-8
Synonym(s):
(S)-2-(Boc-amino)-3-(4-biphenylyl)propionic acid;Boc-4-phenyl-L -phenylalanine;Boc-Bip-OH
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB102.40 | In Stock |
|
| 1G | RMB195.20 | In Stock |
|
| 5G | RMB568.80 | In Stock |
|
| 25G | RMB2056.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-107 °C(lit.) |
| Boiling point: | 528.2±50.0 °C(Predicted) |
| Density | 1.161±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.88±0.10(Predicted) |
| color | White to Off-White |
| optical activity | [α]22/D +21°, c = 2 in methanol |
| Major Application | peptide synthesis |
| InChI | 1S/C20H23NO4/c1-20(2,3)25-19(24)21-17(18(22)23)13-14-9-11-16(12-10-14)15-7-5-4-6-8-15/h4-12,17H,13H2,1-3H3,(H,21,24)(H,22,23)/t17-/m0/s1 |
| InChIKey | NBVVKAUSAGHTSU-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(cc1)-c2ccccc2)C(O)=O |
| CAS DataBase Reference | 147923-08-8(CAS DataBase Reference) |
Description and Uses
N-Boc-4-phenyl-L-phenylalanine is a reactant used in the synthesis of novel phenylalanines derived diamides as factor XIa inhibitors used in the treatment.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361d |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | N,Xi,Xn |
| Risk Statements | 50/53-41-38-20/22-63 |
| Safety Statements | 60-61-36-26-36/37 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 |







