BD8574631
(R)-2-((tert-Butoxycarbonyl)amino)-3-(2,4-dichlorophenyl)propanoic acid , 97% , 114873-12-0
Synonym(s):
Boc-2,4-dichloro-D -phenylalanine
CAS NO.:114873-12-0
Empirical Formula: C14H17Cl2NO4
Molecular Weight: 334.2
MDL number: MFCD01862941
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB67.20 | In Stock |
|
| 1g | RMB182.40 | In Stock |
|
| 5g | RMB592.00 | In Stock |
|
| 10g | RMB972.80 | In Stock |
|
| 25g | RMB1969.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-137 °C |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D +32.5±1°, c = 1% in methanol |
| Major Application | peptide synthesis |
| InChI | 1S/C14H17Cl2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)6-8-4-5-9(15)7-10(8)16/h4-5,7,11H,6H2,1-3H3,(H,17,20)(H,18,19)/t11-/m1/s1 |
| InChIKey | KSDWBXFRQWMWHO-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(Cl)cc1Cl)C(O)=O |
| CAS DataBase Reference | 114873-12-0 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Warning |
| Hazard statements | H228-H290 |
| Precautionary statements | P280-P370+P378r-P390-P403+P233-P406b-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |








