A1426212
(Boc-Cys-OH)<SUB>2</SUB> , ≥98% , 10389-65-8
Synonym(s):
Nα,Nα′-di-Boc-L -cystine
CAS NO.:10389-65-8
Empirical Formula: C16H28N2O8S2
Molecular Weight: 440.53
MDL number: MFCD00038250
EINECS: 233-852-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB121.60 | In Stock |
|
| 25G | RMB286.40 | In Stock |
|
| 100g | RMB712.00 | In Stock |
|
| 500g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-145 °C |
| Boiling point: | 627.4±55.0 °C(Predicted) |
| Density | 1.313±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Acetic Acid (Sparingly) DMSO (Slightly, Sonicated), Methanol (Slightly) |
| pka | 3.17±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D 120±3°, c = 2% in acetic acid |
| BRN | 2229312 |
| Major Application | peptide synthesis |
| InChIKey | MHDQAZHYHAOTKR-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSSC[C@H](NC(=O)OC(C)(C)C)C(O)=O)C(O)=O |
Description and Uses
N,N''-Di-BOC-L-cystine, can be used for the synthesis of Toll-Like Receptor-2 agonists lipopeptides, which are potential vaccine adjuvants.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |






![3-[(2-AMINOETHYL)DITHIO]PROPIONICACID](https://img.chemicalbook.com/CAS/GIF/15579-00-7.gif)