A1429712
3-Bromo-5-nitrosalicylaldehyde , 98% , 16789-84-7
CAS NO.：16789-84-7
Empirical Formula: C7H4BrNO4
Molecular Weight: 246.01
MDL number: MFCD00051833
EINECS: 625-126-9
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB71.20 | In Stock |
|
| 1G | RMB81.60 | In Stock |
|
| 5G | RMB284.80 | In Stock |
|
| 10g | RMB569.60 | In Stock |
|
| 25G | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-149 °C |
| Boiling point: | 299.6±40.0 °C(Predicted) |
| Density | 1.928±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 3.38±0.44(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| Sensitive | Air Sensitive |
| BRN | 1213613 |
| InChI | InChI=1S/C7H4BrNO4/c8-6-2-5(9(12)13)1-4(3-10)7(6)11/h1-3,11H |
| InChIKey | BESBCGANGAEHPM-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC([N+]([O-])=O)=CC(Br)=C1O |
| CAS DataBase Reference | 16789-84-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22 |
| Safety Statements | 36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2913000090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
