A1430112
6-Bromo-2-chloroquinoline , 96% , 1810-71-5
CAS NO.：1810-71-5
Empirical Formula: C9H5BrClN
Molecular Weight: 242.5
MDL number: MFCD04115272
EINECS: 675-964-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.52 | In Stock |
|
| 1G | RMB76.00 | In Stock |
|
| 5G | RMB292.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150℃ |
| Boiling point: | 325.7±22.0 °C(Predicted) |
| Density | 1.673±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble in Chloroform and Methanol |
| form | Solid |
| pka | -0.48±0.43(Predicted) |
| color | White Crystalline |
| InChI | InChI=1S/C9H5BrClN/c10-7-2-3-8-6(5-7)1-4-9(11)12-8/h1-5H |
| InChIKey | YXRDWUJAJLDABJ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(Br)=CC=2)C=CC=1Cl |
| CAS DataBase Reference | 1810-71-5(CAS DataBase Reference) |
Description and Uses
It is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN2811 |
| HS Code | 2933499090 |
