A4519956
6-Bromo-2-chloroquinoline-3-carboxaldehyde , ≥96% , 73568-35-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB479.20 | In Stock |
|
| 1g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-189℃ |
| Boiling point: | 389.8±37.0 °C(Predicted) |
| Density | 1.727 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -2.14±0.50(Predicted) |
| color | White to Gray to Brown |
| InChI | InChI=1S/C10H5BrClNO/c11-8-1-2-9-6(4-8)3-7(5-14)10(12)13-9/h1-5H |
| InChIKey | DCZCMZVZWKXJAF-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(Br)=CC=2)C=C(C=O)C=1Cl |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |