A1433112
4-Bromo-2-chlorobenzonitrile , 96% , 154607-01-9
CAS NO.：154607-01-9
Empirical Formula: C7H3BrClN
Molecular Weight: 216.46
MDL number: MFCD00040883
EINECS: 679-039-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB80.00 | In Stock |
|
| 25G | RMB191.20 | In Stock |
|
| 100G | RMB620.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-68°C |
| Boiling point: | 142-143°C 10mm |
| Density | 1.74±0.1 g/cm3(Predicted) |
| Flash point: | 142-143°C/10mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 3240885 |
| InChI | InChI=1S/C7H3BrClN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| InChIKey | AYQBMZNSJPVADT-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Br)C=C1Cl |
| LogP | 3.14 |
| CAS DataBase Reference | 154607-01-9(CAS DataBase Reference) |
Description and Uses
4-Bromo-2-chlorobenzonitrile is used as a intermediate in organic synthesis and a ligand in transition metal complexes.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H311-H315-H319-H332 |
| Precautionary statements | P280h-P305+P351+P338-P309-P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3439 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
